C25H32N2O7S — CID 134913282
ethyl 2-[[(1S)-6,7-dimethoxy-1-[[(R)-(2-nitrophenyl)sulfinyl]methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]butanoate (PubChem CID 134913282) has the molecular formula C25H32N2O7S and a molecular weight of 504.61 g/mol. Its IUPAC name is ethyl 2-[[(1S)-6,7-dimethoxy-1-[[(R)-(2-nitrophenyl)sulfinyl]methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]butanoate.
| Compound Name | ethyl 2-[[(1S)-6,7-dimethoxy-1-[[(R)-(2-nitrophenyl)sulfinyl]methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]butanoate |
|---|---|
| PubChem CID | 134913282 |
| Molecular Formula | C25H32N2O7S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | ethyl 2-[[(1S)-6,7-dimethoxy-1-[[(R)-(2-nitrophenyl)sulfinyl]methyl]-3,4-dihydro-1H-isoquinolin-2-yl]methyl]butanoate |
| SMILES | CCOC(=O)C(CC)CN1CCc2cc(OC)c(OC)cc2[C@H]1C[S@@](=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H32N2O7S/c1-5-17(25(28)34-6-2)15-26-12-11-18-13-22(32-3)23(33-4)14-19(18)21(26)16-35(31)24-10-8-7-9-20(24)27(29)30/h7-10,13-14,17,21H,5-6,11-12,15-16H2,1-4H3/t17?,21-,35-/m1/s1 |
| InChIKey | GGHZJNBKFWNTHJ-MJLOKXTLSA-N |
| XLogP | 3.91 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|