C22H20N2O5S — CID 16959318
(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-nitrophenyl)methanone (PubChem CID 16959318) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-nitrophenyl)methanone.
| Compound Name | (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 16959318 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(2-nitrophenyl)methanone |
| SMILES | COc1cc2c(cc1OC)C(c1cccs1)N(C(=O)c1ccccc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C22H20N2O5S/c1-28-18-12-14-9-10-23(22(25)15-6-3-4-7-17(15)24(26)27)21(20-8-5-11-30-20)16(14)13-19(18)29-2/h3-8,11-13,21H,9-10H2,1-2H3 |
| InChIKey | UWXBKLLFGFVQAZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|