C20H18N2O5S2 — CID 112793909
(6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(5-nitrothiophen-2-yl)methanone (PubChem CID 112793909) has the molecular formula C20H18N2O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(5-nitrothiophen-2-yl)methanone.
| Compound Name | (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(5-nitrothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 112793909 |
| Molecular Formula | C20H18N2O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | (6,7-dimethoxy-1-thiophen-2-yl-3,4-dihydro-1H-isoquinolin-2-yl)-(5-nitrothiophen-2-yl)methanone |
| SMILES | COc1cc2c(cc1OC)C(c1cccs1)N(C(=O)c1ccc([N+](=O)[O-])s1)CC2 |
| InChI | InChI=1S/C20H18N2O5S2/c1-26-14-10-12-7-8-21(20(23)17-5-6-18(29-17)22(24)25)19(16-4-3-9-28-16)13(12)11-15(14)27-2/h3-6,9-11,19H,7-8H2,1-2H3 |
| InChIKey | OMGJPOBWJXLCMD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|