C20H26N2O5S — CID 24806422
N-hexyl-N-(4-nitro-2-phenylmethoxyphenyl)methanesulfonamide (PubChem CID 24806422) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is N-hexyl-N-(4-nitro-2-phenylmethoxyphenyl)methanesulfonamide.
| Compound Name | N-hexyl-N-(4-nitro-2-phenylmethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 24806422 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-hexyl-N-(4-nitro-2-phenylmethoxyphenyl)methanesulfonamide |
| SMILES | CCCCCCN(c1ccc([N+](=O)[O-])cc1OCc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H26N2O5S/c1-3-4-5-9-14-21(28(2,25)26)19-13-12-18(22(23)24)15-20(19)27-16-17-10-7-6-8-11-17/h6-8,10-13,15H,3-5,9,14,16H2,1-2H3 |
| InChIKey | SPAHGCJMJMYKQH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|