C18H23N3O5S — CID 139919218
N-(5-aminopentyl)-4-nitro-N-phenylmethoxybenzenesulfonamide (PubChem CID 139919218) has the molecular formula C18H23N3O5S and a molecular weight of 393.46 g/mol. Its IUPAC name is N-(5-aminopentyl)-4-nitro-N-phenylmethoxybenzenesulfonamide.
| Compound Name | N-(5-aminopentyl)-4-nitro-N-phenylmethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 139919218 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(5-aminopentyl)-4-nitro-N-phenylmethoxybenzenesulfonamide |
| SMILES | NCCCCCN(OCc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H23N3O5S/c19-13-5-2-6-14-20(26-15-16-7-3-1-4-8-16)27(24,25)18-11-9-17(10-12-18)21(22)23/h1,3-4,7-12H,2,5-6,13-15,19H2 |
| InChIKey | UKLVFGOVRNUPIS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|