About (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate
(4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate (PubChem CID 55687868) has the molecular formula C18H19NO6S
and a molecular weight of 377.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate |
| PubChem CID | 55687868 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate |
| SMILES | O=C(CS(=O)(=O)CCCc1ccccc1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19NO6S/c20-18(25-13-16-8-10-17(11-9-16)19(21)22)14-26(23,24)12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11H,4,7,12-14H2 |
| InChIKey | XWKJUHZFCGVYNX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate?
The IUPAC name of (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate (CID 55687868) is (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate.
What is the SMILES notation for (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate?
The canonical SMILES for (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate is O=C(CS(=O)(=O)CCCc1ccccc1)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate?
The InChIKey is XWKJUHZFCGVYNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO6S/c20-18(25-13-16-8-10-17(11-9-16)19(21)22)14-26(23,24)12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11H,4,7,12-14H2.
What are the key properties of (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate?
(4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate has a molecular weight of 377.42 g/mol, XLogP of 2.69, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl 2-(3-phenylpropylsulfonyl)acetate is sourced from PubChem (CID 55687868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).