C20H23N3O6 — CID 21363112
(2S)-6-amino-2-(4-nitro-N-phenylmethoxycarbonylanilino)hexanoic acid (PubChem CID 21363112) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is (2S)-6-amino-2-(4-nitro-N-phenylmethoxycarbonylanilino)hexanoic acid.
| Compound Name | (2S)-6-amino-2-(4-nitro-N-phenylmethoxycarbonylanilino)hexanoic acid |
|---|---|
| PubChem CID | 21363112 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2S)-6-amino-2-(4-nitro-N-phenylmethoxycarbonylanilino)hexanoic acid |
| SMILES | NCCCC[C@@H](C(=O)O)N(C(=O)OCc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H23N3O6/c21-13-5-4-8-18(19(24)25)22(16-9-11-17(12-10-16)23(27)28)20(26)29-14-15-6-2-1-3-7-15/h1-3,6-7,9-12,18H,4-5,8,13-14,21H2,(H,24,25)/t18-/m0/s1 |
| InChIKey | BHGLXXYBVFZSJE-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|