C14H19N5O4 — CID 77179098
6-amino-2-[azido(phenylmethoxycarbonyl)amino]hexanoic acid (PubChem CID 77179098) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is 6-amino-2-[azido(phenylmethoxycarbonyl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[azido(phenylmethoxycarbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 77179098 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 6-amino-2-[azido(phenylmethoxycarbonyl)amino]hexanoic acid |
| SMILES | [N-]=[N+]=NN(C(=O)OCc1ccccc1)C(CCCCN)C(=O)O |
| InChI | InChI=1S/C14H19N5O4/c15-9-5-4-8-12(13(20)21)19(18-17-16)14(22)23-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,20,21) |
| InChIKey | JTEDFOYUYRPPNN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|