C10H14N6O4 — CID 126572368
6-amino-2-[azido-(2,5-dioxopyrrol-1-yl)amino]hexanoic acid (PubChem CID 126572368) has the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 6-amino-2-[azido-(2,5-dioxopyrrol-1-yl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[azido-(2,5-dioxopyrrol-1-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 126572368 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-amino-2-[azido-(2,5-dioxopyrrol-1-yl)amino]hexanoic acid |
| SMILES | [N-]=[N+]=NN(C(CCCCN)C(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14N6O4/c11-6-2-1-3-7(10(19)20)16(14-13-12)15-8(17)4-5-9(15)18/h4-5,7H,1-3,6,11H2,(H,19,20) |
| InChIKey | DFEKAUQPCZORRI-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 152.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|