C20H18N2O — CID 22611381
7-phenylmethoxy-5,10-dihydrocyclohepta[b]indol-4-amine (PubChem CID 22611381) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 7-phenylmethoxy-5,10-dihydrocyclohepta[b]indol-4-amine.
| Compound Name | 7-phenylmethoxy-5,10-dihydrocyclohepta[b]indol-4-amine |
|---|---|
| PubChem CID | 22611381 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 7-phenylmethoxy-5,10-dihydrocyclohepta[b]indol-4-amine |
| SMILES | Nc1cccc2c3c([nH]c12)C=C(OCc1ccccc1)C=CC3 |
| InChI | InChI=1S/C20H18N2O/c21-18-11-5-10-17-16-9-4-8-15(12-19(16)22-20(17)18)23-13-14-6-2-1-3-7-14/h1-8,10-12,22H,9,13,21H2 |
| InChIKey | LINXARZSIQFPHG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|