C21H19N3O2 — CID 22611312
benzyl N-(4-amino-5,10-dihydrocyclohepta[b]indol-7-yl)carbamate (PubChem CID 22611312) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is benzyl N-(4-amino-5,10-dihydrocyclohepta[b]indol-7-yl)carbamate.
| Compound Name | benzyl N-(4-amino-5,10-dihydrocyclohepta[b]indol-7-yl)carbamate |
|---|---|
| PubChem CID | 22611312 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | benzyl N-(4-amino-5,10-dihydrocyclohepta[b]indol-7-yl)carbamate |
| SMILES | Nc1cccc2c3c([nH]c12)C=C(NC(=O)OCc1ccccc1)C=CC3 |
| InChI | InChI=1S/C21H19N3O2/c22-18-11-5-10-17-16-9-4-8-15(12-19(16)24-20(17)18)23-21(25)26-13-14-6-2-1-3-7-14/h1-8,10-12,24H,9,13,22H2,(H,23,25) |
| InChIKey | OAHVGTOKNZQCKD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|