C17H20O2 — CID 139881236
5-ethenyl-2-ethoxy-5-phenylmethoxycyclohexa-1,3-diene (PubChem CID 139881236) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 5-ethenyl-2-ethoxy-5-phenylmethoxycyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-2-ethoxy-5-phenylmethoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139881236 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 5-ethenyl-2-ethoxy-5-phenylmethoxycyclohexa-1,3-diene |
| SMILES | C=CC1(OCc2ccccc2)C=CC(OCC)=CC1 |
| InChI | InChI=1S/C17H20O2/c1-3-17(12-10-16(11-13-17)18-4-2)19-14-15-8-6-5-7-9-15/h3,5-12H,1,4,13-14H2,2H3 |
| InChIKey | FABHGEVGAZQRHM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|