C21H36O2 — CID 139905552
5-(2-decoxyethenyl)-2-ethoxy-5-methylcyclohexa-1,3-diene (PubChem CID 139905552) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 5-(2-decoxyethenyl)-2-ethoxy-5-methylcyclohexa-1,3-diene.
| Compound Name | 5-(2-decoxyethenyl)-2-ethoxy-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 139905552 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 5-(2-decoxyethenyl)-2-ethoxy-5-methylcyclohexa-1,3-diene |
| SMILES | CCCCCCCCCCOC=CC1(C)C=CC(OCC)=CC1 |
| InChI | InChI=1S/C21H36O2/c1-4-6-7-8-9-10-11-12-18-22-19-17-21(3)15-13-20(14-16-21)23-5-2/h13-15,17,19H,4-12,16,18H2,1-3H3 |
| InChIKey | FZAZAKRCYUPFNH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|