C14H24O3 — CID 174365510
2-hexoxy-5,5-dimethoxycyclohexa-1,3-diene (PubChem CID 174365510) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 2-hexoxy-5,5-dimethoxycyclohexa-1,3-diene.
| Compound Name | 2-hexoxy-5,5-dimethoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174365510 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-hexoxy-5,5-dimethoxycyclohexa-1,3-diene |
| SMILES | CCCCCCOC1=CCC(OC)(OC)C=C1 |
| InChI | InChI=1S/C14H24O3/c1-4-5-6-7-12-17-13-8-10-14(15-2,16-3)11-9-13/h8-10H,4-7,11-12H2,1-3H3 |
| InChIKey | SWTBFNXQSLFJPM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|