C21H32O — CID 144958919
2-buta-2,3-dien-2-yl-5-decoxycyclohepta-1,3,5-triene (PubChem CID 144958919) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is 2-buta-2,3-dien-2-yl-5-decoxycyclohepta-1,3,5-triene.
| Compound Name | 2-buta-2,3-dien-2-yl-5-decoxycyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 144958919 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 2-buta-2,3-dien-2-yl-5-decoxycyclohepta-1,3,5-triene |
| SMILES | C=C=C(C)C1=CCC=C(OCCCCCCCCCC)C=C1 |
| InChI | InChI=1S/C21H32O/c1-4-6-7-8-9-10-11-12-18-22-21-15-13-14-20(16-17-21)19(3)5-2/h14-17H,2,4,6-13,18H2,1,3H3 |
| InChIKey | KRRDCAQUDAZUFR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|