C36H58O — CID 141102231
5-nonyl-2-(4-nonyl-4-prop-2-enylcyclohexa-1,5-dien-1-yl)oxy-5-prop-2-enylcyclohexa-1,3-diene (PubChem CID 141102231) has the molecular formula C36H58O and a molecular weight of 506.86 g/mol. Its IUPAC name is 5-nonyl-2-(4-nonyl-4-prop-2-enylcyclohexa-1,5-dien-1-yl)oxy-5-prop-2-enylcyclohexa-1,3-diene.
| Compound Name | 5-nonyl-2-(4-nonyl-4-prop-2-enylcyclohexa-1,5-dien-1-yl)oxy-5-prop-2-enylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141102231 |
| Molecular Formula | C36H58O |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.45 |
| IUPAC Name | 5-nonyl-2-(4-nonyl-4-prop-2-enylcyclohexa-1,5-dien-1-yl)oxy-5-prop-2-enylcyclohexa-1,3-diene |
| SMILES | C=CCC1(CCCCCCCCC)C=CC(OC2=CCC(CC=C)(CCCCCCCCC)C=C2)=CC1 |
| InChI | InChI=1S/C36H58O/c1-5-9-11-13-15-17-19-27-35(25-7-3)29-21-33(22-30-35)37-34-23-31-36(26-8-4,32-24-34)28-20-18-16-14-12-10-6-2/h7-8,21-24,29,31H,3-6,9-20,25-28,30,32H2,1-2H3 |
| InChIKey | SYTRCWZGIVLJAX-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|