C40H77O3P — CID 175809540
2-[2-ethylhexoxy(2-ethylhexyl)phosphoryl]oxy-5,5-di(nonyl)cyclohexa-1,3-diene (PubChem CID 175809540) has the molecular formula C40H77O3P and a molecular weight of 637.03 g/mol. Its IUPAC name is 2-[2-ethylhexoxy(2-ethylhexyl)phosphoryl]oxy-5,5-di(nonyl)cyclohexa-1,3-diene.
| Compound Name | 2-[2-ethylhexoxy(2-ethylhexyl)phosphoryl]oxy-5,5-di(nonyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175809540 |
| Molecular Formula | C40H77O3P |
| Molecular Weight | 637.03 g/mol |
| Exact Mass | 636.56 |
| IUPAC Name | 2-[2-ethylhexoxy(2-ethylhexyl)phosphoryl]oxy-5,5-di(nonyl)cyclohexa-1,3-diene |
| SMILES | CCCCCCCCCC1(CCCCCCCCC)C=CC(OP(=O)(CC(CC)CCCC)OCC(CC)CCCC)=CC1 |
| InChI | InChI=1S/C40H77O3P/c1-7-13-17-19-21-23-25-31-40(32-26-24-22-20-18-14-8-2)33-29-39(30-34-40)43-44(41,36-38(12-6)28-16-10-4)42-35-37(11-5)27-15-9-3/h29-30,33,37-38H,7-28,31-32,34-36H2,1-6H3 |
| InChIKey | YMTFVAPYFUPMOJ-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.03 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|