C16H26 — CID 141421761
2,5-dibutyl-5-ethenylcyclohexa-1,3-diene (PubChem CID 141421761) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 2,5-dibutyl-5-ethenylcyclohexa-1,3-diene.
| Compound Name | 2,5-dibutyl-5-ethenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141421761 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 2,5-dibutyl-5-ethenylcyclohexa-1,3-diene |
| SMILES | C=CC1(CCCC)C=CC(CCCC)=CC1 |
| InChI | InChI=1S/C16H26/c1-4-7-9-15-10-13-16(6-3,14-11-15)12-8-5-2/h6,10-11,13H,3-5,7-9,12,14H2,1-2H3 |
| InChIKey | ZZPZOAJGALQCSU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|