C30H53NO3 — CID 172842425
5-[[4,4-di(nonyl)cyclohexa-1,5-dien-1-yl]methylamino]-5-oxopentanoic acid (PubChem CID 172842425) has the molecular formula C30H53NO3 and a molecular weight of 475.76 g/mol. Its IUPAC name is 5-[[4,4-di(nonyl)cyclohexa-1,5-dien-1-yl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[4,4-di(nonyl)cyclohexa-1,5-dien-1-yl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 172842425 |
| Molecular Formula | C30H53NO3 |
| Molecular Weight | 475.76 g/mol |
| Exact Mass | 475.40 |
| IUPAC Name | 5-[[4,4-di(nonyl)cyclohexa-1,5-dien-1-yl]methylamino]-5-oxopentanoic acid |
| SMILES | CCCCCCCCCC1(CCCCCCCCC)C=CC(CNC(=O)CCCC(=O)O)=CC1 |
| InChI | InChI=1S/C30H53NO3/c1-3-5-7-9-11-13-15-22-30(23-16-14-12-10-8-6-4-2)24-20-27(21-25-30)26-31-28(32)18-17-19-29(33)34/h20-21,24H,3-19,22-23,25-26H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | WYXAQDNHXJLZBQ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.76 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|