C22H25NO2 — CID 69278382
4-(dibenzylamino)-4-ethoxycyclohexa-1,5-dien-1-ol (PubChem CID 69278382) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-(dibenzylamino)-4-ethoxycyclohexa-1,5-dien-1-ol.
| Compound Name | 4-(dibenzylamino)-4-ethoxycyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 69278382 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-(dibenzylamino)-4-ethoxycyclohexa-1,5-dien-1-ol |
| SMILES | CCOC1(N(Cc2ccccc2)Cc2ccccc2)C=CC(O)=CC1 |
| InChI | InChI=1S/C22H25NO2/c1-2-25-22(15-13-21(24)14-16-22)23(17-19-9-5-3-6-10-19)18-20-11-7-4-8-12-20/h3-15,24H,2,16-18H2,1H3 |
| InChIKey | BMEXHOINXKGJMH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|