C17H24N2O5 — CID 10735592
diethyl 2-[[benzyl(methyl)amino]methyl]-2-formamidopropanedioate (PubChem CID 10735592) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is diethyl 2-[[benzyl(methyl)amino]methyl]-2-formamidopropanedioate.
| Compound Name | diethyl 2-[[benzyl(methyl)amino]methyl]-2-formamidopropanedioate |
|---|---|
| PubChem CID | 10735592 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | diethyl 2-[[benzyl(methyl)amino]methyl]-2-formamidopropanedioate |
| SMILES | CCOC(=O)C(CN(C)Cc1ccccc1)(NC=O)C(=O)OCC |
| InChI | InChI=1S/C17H24N2O5/c1-4-23-15(21)17(18-13-20,16(22)24-5-2)12-19(3)11-14-9-7-6-8-10-14/h6-10,13H,4-5,11-12H2,1-3H3,(H,18,20) |
| InChIKey | KTZVKXWUIUYHGA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|