C18H20N2O5 — CID 54322974
diethyl 2-formamido-2-(quinolin-8-ylmethyl)propanedioate (PubChem CID 54322974) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is diethyl 2-formamido-2-(quinolin-8-ylmethyl)propanedioate.
| Compound Name | diethyl 2-formamido-2-(quinolin-8-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 54322974 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | diethyl 2-formamido-2-(quinolin-8-ylmethyl)propanedioate |
| SMILES | CCOC(=O)C(Cc1cccc2cccnc12)(NC=O)C(=O)OCC |
| InChI | InChI=1S/C18H20N2O5/c1-3-24-16(22)18(20-12-21,17(23)25-4-2)11-14-8-5-7-13-9-6-10-19-15(13)14/h5-10,12H,3-4,11H2,1-2H3,(H,20,21) |
| InChIKey | SSXUMSWGUSSQKL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|