C19H23N3O6 — CID 14268620
diethyl 2-[(4-acetamido-1H-indol-3-yl)methyl]-2-formamidopropanedioate (PubChem CID 14268620) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is diethyl 2-[(4-acetamido-1H-indol-3-yl)methyl]-2-formamidopropanedioate.
| Compound Name | diethyl 2-[(4-acetamido-1H-indol-3-yl)methyl]-2-formamidopropanedioate |
|---|---|
| PubChem CID | 14268620 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | diethyl 2-[(4-acetamido-1H-indol-3-yl)methyl]-2-formamidopropanedioate |
| SMILES | CCOC(=O)C(Cc1c[nH]c2cccc(NC(C)=O)c12)(NC=O)C(=O)OCC |
| InChI | InChI=1S/C19H23N3O6/c1-4-27-17(25)19(21-11-23,18(26)28-5-2)9-13-10-20-14-7-6-8-15(16(13)14)22-12(3)24/h6-8,10-11,20H,4-5,9H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | OHPHISGNOUGWDH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|