C16H20FNO6 — CID 91250283
diethyl 2-[(2-fluoro-5-methoxyphenyl)methyl]-2-formamidopropanedioate (PubChem CID 91250283) has the molecular formula C16H20FNO6 and a molecular weight of 341.34 g/mol. Its IUPAC name is diethyl 2-[(2-fluoro-5-methoxyphenyl)methyl]-2-formamidopropanedioate.
| Compound Name | diethyl 2-[(2-fluoro-5-methoxyphenyl)methyl]-2-formamidopropanedioate |
|---|---|
| PubChem CID | 91250283 |
| Molecular Formula | C16H20FNO6 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | diethyl 2-[(2-fluoro-5-methoxyphenyl)methyl]-2-formamidopropanedioate |
| SMILES | CCOC(=O)C(Cc1cc(OC)ccc1F)(NC=O)C(=O)OCC |
| InChI | InChI=1S/C16H20FNO6/c1-4-23-14(20)16(18-10-19,15(21)24-5-2)9-11-8-12(22-3)6-7-13(11)17/h6-8,10H,4-5,9H2,1-3H3,(H,18,19) |
| InChIKey | LOIOABYHOKPRRS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|