C17H21N3O5 — CID 14268612
diethyl 2-[(4-amino-1H-indol-3-yl)methyl]-2-formamidopropanedioate (PubChem CID 14268612) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is diethyl 2-[(4-amino-1H-indol-3-yl)methyl]-2-formamidopropanedioate.
| Compound Name | diethyl 2-[(4-amino-1H-indol-3-yl)methyl]-2-formamidopropanedioate |
|---|---|
| PubChem CID | 14268612 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | diethyl 2-[(4-amino-1H-indol-3-yl)methyl]-2-formamidopropanedioate |
| SMILES | CCOC(=O)C(Cc1c[nH]c2cccc(N)c12)(NC=O)C(=O)OCC |
| InChI | InChI=1S/C17H21N3O5/c1-3-24-15(22)17(20-10-21,16(23)25-4-2)8-11-9-19-13-7-5-6-12(18)14(11)13/h5-7,9-10,19H,3-4,8,18H2,1-2H3,(H,20,21) |
| InChIKey | YTRIBELGGAXOIH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|