C12H12FNO6 — CID 87997182
2-[(2-fluoro-5-methoxyphenyl)methyl]-2-formamidopropanedioic acid (PubChem CID 87997182) has the molecular formula C12H12FNO6 and a molecular weight of 285.23 g/mol. Its IUPAC name is 2-[(2-fluoro-5-methoxyphenyl)methyl]-2-formamidopropanedioic acid.
| Compound Name | 2-[(2-fluoro-5-methoxyphenyl)methyl]-2-formamidopropanedioic acid |
|---|---|
| PubChem CID | 87997182 |
| Molecular Formula | C12H12FNO6 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[(2-fluoro-5-methoxyphenyl)methyl]-2-formamidopropanedioic acid |
| SMILES | COc1ccc(F)c(CC(NC=O)(C(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C12H12FNO6/c1-20-8-2-3-9(13)7(4-8)5-12(10(16)17,11(18)19)14-6-15/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | NFDDZFPZTBZJFL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|