C10H13FN2O5S — CID 166400734
2-[(2-fluoro-5-methoxyphenyl)methylsulfamoylamino]acetic acid (PubChem CID 166400734) has the molecular formula C10H13FN2O5S and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[(2-fluoro-5-methoxyphenyl)methylsulfamoylamino]acetic acid.
| Compound Name | 2-[(2-fluoro-5-methoxyphenyl)methylsulfamoylamino]acetic acid |
|---|---|
| PubChem CID | 166400734 |
| Molecular Formula | C10H13FN2O5S |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-[(2-fluoro-5-methoxyphenyl)methylsulfamoylamino]acetic acid |
| SMILES | COc1ccc(F)c(CNS(=O)(=O)NCC(=O)O)c1 |
| InChI | InChI=1S/C10H13FN2O5S/c1-18-8-2-3-9(11)7(4-8)5-12-19(16,17)13-6-10(14)15/h2-4,12-13H,5-6H2,1H3,(H,14,15) |
| InChIKey | RXYJHGHYYMVQNY-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |