C16H16FNO6S — CID 9160130
3-[(2,5-dimethoxyphenyl)methylsulfamoyl]-4-fluorobenzoic acid (PubChem CID 9160130) has the molecular formula C16H16FNO6S and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)methylsulfamoyl]-4-fluorobenzoic acid.
| Compound Name | 3-[(2,5-dimethoxyphenyl)methylsulfamoyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 9160130 |
| Molecular Formula | C16H16FNO6S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-[(2,5-dimethoxyphenyl)methylsulfamoyl]-4-fluorobenzoic acid |
| SMILES | COc1ccc(OC)c(CNS(=O)(=O)c2cc(C(=O)O)ccc2F)c1 |
| InChI | InChI=1S/C16H16FNO6S/c1-23-12-4-6-14(24-2)11(7-12)9-18-25(21,22)15-8-10(16(19)20)3-5-13(15)17/h3-8,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | GPDYDFOVDYDNKM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |