C17H19NO5 — CID 131843012
diethyl 2-formamido-2-(3-phenylprop-2-ynyl)propanedioate (PubChem CID 131843012) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is diethyl 2-formamido-2-(3-phenylprop-2-ynyl)propanedioate.
| Compound Name | diethyl 2-formamido-2-(3-phenylprop-2-ynyl)propanedioate |
|---|---|
| PubChem CID | 131843012 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | diethyl 2-formamido-2-(3-phenylprop-2-ynyl)propanedioate |
| SMILES | CCOC(=O)C(CC#Cc1ccccc1)(NC=O)C(=O)OCC |
| InChI | InChI=1S/C17H19NO5/c1-3-22-15(20)17(18-13-19,16(21)23-4-2)12-8-11-14-9-6-5-7-10-14/h5-7,9-10,13H,3-4,12H2,1-2H3,(H,18,19) |
| InChIKey | QVCSXXNBOUDNCR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|