C15H18O2 — CID 10775823
(2S,3S)-3-ethenyl-2-methyl-3-phenylmethoxy-2,6-dihydropyran (PubChem CID 10775823) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2S,3S)-3-ethenyl-2-methyl-3-phenylmethoxy-2,6-dihydropyran.
| Compound Name | (2S,3S)-3-ethenyl-2-methyl-3-phenylmethoxy-2,6-dihydropyran |
|---|---|
| PubChem CID | 10775823 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2S,3S)-3-ethenyl-2-methyl-3-phenylmethoxy-2,6-dihydropyran |
| SMILES | C=C[C@]1(OCc2ccccc2)C=CCO[C@H]1C |
| InChI | InChI=1S/C15H18O2/c1-3-15(10-7-11-16-13(15)2)17-12-14-8-5-4-6-9-14/h3-10,13H,1,11-12H2,2H3/t13-,15-/m0/s1 |
| InChIKey | XABQRYSKJKEZNJ-ZFWWWQNUSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|