C16H24O3 — CID 21397275
5-methyl-2-(2-methylpropyl)-5-phenylmethoxy-1,3-dioxane (PubChem CID 21397275) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 5-methyl-2-(2-methylpropyl)-5-phenylmethoxy-1,3-dioxane.
| Compound Name | 5-methyl-2-(2-methylpropyl)-5-phenylmethoxy-1,3-dioxane |
|---|---|
| PubChem CID | 21397275 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-methyl-2-(2-methylpropyl)-5-phenylmethoxy-1,3-dioxane |
| SMILES | CC(C)CC1OCC(C)(OCc2ccccc2)CO1 |
| InChI | InChI=1S/C16H24O3/c1-13(2)9-15-17-11-16(3,12-18-15)19-10-14-7-5-4-6-8-14/h4-8,13,15H,9-12H2,1-3H3 |
| InChIKey | JQHHIOFUMXPNCH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |