About 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane
5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane (PubChem CID 67722972) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane |
| PubChem CID | 67722972 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane |
| SMILES | CC(OCc1ccccc1)C1OCC(C)(C)CO1 |
| InChI | InChI=1S/C15H22O3/c1-12(14-17-10-15(2,3)11-18-14)16-9-13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3 |
| InChIKey | FROCRKNBTFQGEG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane?
The IUPAC name of 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane (CID 67722972) is 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane.
What is the SMILES notation for 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane?
The canonical SMILES for 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane is CC(OCc1ccccc1)C1OCC(C)(C)CO1.
What is the InChIKey of 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane?
The InChIKey is FROCRKNBTFQGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-12(14-17-10-15(2,3)11-18-14)16-9-13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3.
What are the key properties of 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane?
5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane has a molecular weight of 250.34 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane is sourced from PubChem (CID 67722972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).