C15H22O3 — CID 67722972
5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane (PubChem CID 67722972) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane.
| Compound Name | 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 67722972 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 5,5-dimethyl-2-(1-phenylmethoxyethyl)-1,3-dioxane |
| SMILES | CC(OCc1ccccc1)C1OCC(C)(C)CO1 |
| InChI | InChI=1S/C15H22O3/c1-12(14-17-10-15(2,3)11-18-14)16-9-13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3 |
| InChIKey | FROCRKNBTFQGEG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |