C14H20BO4- — CID 10611547
4-methyl-1-[(1R)-1-phenylmethoxyethyl]-2,6,7-trioxa-1-boranuidabicyclo[2.2.2]octane (PubChem CID 10611547) has the molecular formula C14H20BO4- and a molecular weight of 263.12 g/mol. Its IUPAC name is 4-methyl-1-[(1R)-1-phenylmethoxyethyl]-2,6,7-trioxa-1-boranuidabicyclo[2.2.2]octane.
| Compound Name | 4-methyl-1-[(1R)-1-phenylmethoxyethyl]-2,6,7-trioxa-1-boranuidabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 10611547 |
| Molecular Formula | C14H20BO4- |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-methyl-1-[(1R)-1-phenylmethoxyethyl]-2,6,7-trioxa-1-boranuidabicyclo[2.2.2]octane |
| SMILES | C[C@H](OCc1ccccc1)[B-]12OCC(C)(CO1)CO2 |
| InChI | InChI=1S/C14H20BO4/c1-12(16-8-13-6-4-3-5-7-13)15-17-9-14(2,10-18-15)11-19-15/h3-7,12H,8-11H2,1-2H3/q-1/t12-,14?,15?/m0/s1 |
| InChIKey | KWHYCYRSMOTMNJ-GRTSSRMGSA-N |
| XLogP | 2.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|