C16H22O3 — CID 122395053
(4R)-3,3-dimethyl-4-[(1S)-2-methyl-1-phenylmethoxypropyl]oxetan-2-one (PubChem CID 122395053) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4R)-3,3-dimethyl-4-[(1S)-2-methyl-1-phenylmethoxypropyl]oxetan-2-one.
| Compound Name | (4R)-3,3-dimethyl-4-[(1S)-2-methyl-1-phenylmethoxypropyl]oxetan-2-one |
|---|---|
| PubChem CID | 122395053 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4R)-3,3-dimethyl-4-[(1S)-2-methyl-1-phenylmethoxypropyl]oxetan-2-one |
| SMILES | CC(C)[C@H](OCc1ccccc1)[C@@H]1OC(=O)C1(C)C |
| InChI | InChI=1S/C16H22O3/c1-11(2)13(14-16(3,4)15(17)19-14)18-10-12-8-6-5-7-9-12/h5-9,11,13-14H,10H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | OXQOJRMLFGZTTQ-KBPBESRZSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|