C8H14O3 — CID 10487150
(4R)-4-[(1S)-1-methoxyethyl]-3,3-dimethyloxetan-2-one (PubChem CID 10487150) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (4R)-4-[(1S)-1-methoxyethyl]-3,3-dimethyloxetan-2-one.
| Compound Name | (4R)-4-[(1S)-1-methoxyethyl]-3,3-dimethyloxetan-2-one |
|---|---|
| PubChem CID | 10487150 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (4R)-4-[(1S)-1-methoxyethyl]-3,3-dimethyloxetan-2-one |
| SMILES | CO[C@@H](C)[C@@H]1OC(=O)C1(C)C |
| InChI | InChI=1S/C8H14O3/c1-5(10-4)6-8(2,3)7(9)11-6/h5-6H,1-4H3/t5-,6-/m0/s1 |
| InChIKey | KYNNLQDKMCTMEX-WDSKDSINSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|