C9H16O4 — CID 129073905
4-(2,3-dihydroxybutan-2-yl)-3,3-dimethyloxetan-2-one (PubChem CID 129073905) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 4-(2,3-dihydroxybutan-2-yl)-3,3-dimethyloxetan-2-one.
| Compound Name | 4-(2,3-dihydroxybutan-2-yl)-3,3-dimethyloxetan-2-one |
|---|---|
| PubChem CID | 129073905 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 4-(2,3-dihydroxybutan-2-yl)-3,3-dimethyloxetan-2-one |
| SMILES | CC(O)C(C)(O)C1OC(=O)C1(C)C |
| InChI | InChI=1S/C9H16O4/c1-5(10)9(4,12)6-8(2,3)7(11)13-6/h5-6,10,12H,1-4H3 |
| InChIKey | NCAOADKILMUCJB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|