C11H20O3 — CID 550947
2-tert-butyl-5,5,6-trimethyl-1,3-dioxan-4-one (PubChem CID 550947) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-tert-butyl-5,5,6-trimethyl-1,3-dioxan-4-one.
| Compound Name | 2-tert-butyl-5,5,6-trimethyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 550947 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-tert-butyl-5,5,6-trimethyl-1,3-dioxan-4-one |
| SMILES | CC1OC(C(C)(C)C)OC(=O)C1(C)C |
| InChI | InChI=1S/C11H20O3/c1-7-11(5,6)8(12)14-9(13-7)10(2,3)4/h7,9H,1-6H3 |
| InChIKey | YZBJBZSVYHRLLU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |