C10H18O3 — CID 14114159
(2R)-2-tert-butyl-6,6-dimethyl-1,3-dioxan-4-one (PubChem CID 14114159) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2R)-2-tert-butyl-6,6-dimethyl-1,3-dioxan-4-one.
| Compound Name | (2R)-2-tert-butyl-6,6-dimethyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 14114159 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2R)-2-tert-butyl-6,6-dimethyl-1,3-dioxan-4-one |
| SMILES | CC1(C)CC(=O)O[C@H](C(C)(C)C)O1 |
| InChI | InChI=1S/C10H18O3/c1-9(2,3)8-12-7(11)6-10(4,5)13-8/h8H,6H2,1-5H3/t8-/m0/s1 |
| InChIKey | ULAREYUOECVIHI-QMMMGPOBSA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |