C15H26O4 — CID 140975649
2-tert-butyl-1,3-dioxacyclotridecane-4,13-dione (PubChem CID 140975649) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dioxacyclotridecane-4,13-dione.
| Compound Name | 2-tert-butyl-1,3-dioxacyclotridecane-4,13-dione |
|---|---|
| PubChem CID | 140975649 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-tert-butyl-1,3-dioxacyclotridecane-4,13-dione |
| SMILES | CC(C)(C)C1OC(=O)CCCCCCCCC(=O)O1 |
| InChI | InChI=1S/C15H26O4/c1-15(2,3)14-18-12(16)10-8-6-4-5-7-9-11-13(17)19-14/h14H,4-11H2,1-3H3 |
| InChIKey | SWXYCSLUGYZFCV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |