C17H30O4 — CID 18006200
2-methyl-1,4-dioxacyclooctadecane-5,18-dione (PubChem CID 18006200) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 2-methyl-1,4-dioxacyclooctadecane-5,18-dione.
| Compound Name | 2-methyl-1,4-dioxacyclooctadecane-5,18-dione |
|---|---|
| PubChem CID | 18006200 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-methyl-1,4-dioxacyclooctadecane-5,18-dione |
| SMILES | CC1COC(=O)CCCCCCCCCCCCC(=O)O1 |
| InChI | InChI=1S/C17H30O4/c1-15-14-20-16(18)12-10-8-6-4-2-3-5-7-9-11-13-17(19)21-15/h15H,2-14H2,1H3 |
| InChIKey | XBVFGIFCFKCQTR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |