C12H21NO3 — CID 71819182
2-methyl-1-oxa-5-azacyclotridecane-6,13-dione (PubChem CID 71819182) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-methyl-1-oxa-5-azacyclotridecane-6,13-dione.
| Compound Name | 2-methyl-1-oxa-5-azacyclotridecane-6,13-dione |
|---|---|
| PubChem CID | 71819182 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-methyl-1-oxa-5-azacyclotridecane-6,13-dione |
| SMILES | CC1CCNC(=O)CCCCCCC(=O)O1 |
| InChI | InChI=1S/C12H21NO3/c1-10-8-9-13-11(14)6-4-2-3-5-7-12(15)16-10/h10H,2-9H2,1H3,(H,13,14) |
| InChIKey | RBKVZBDTEAPOIM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |