C13H22O4 — CID 7075077
(2R)-2-methyl-1,4-dioxacyclotetradecane-5,14-dione (PubChem CID 7075077) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (2R)-2-methyl-1,4-dioxacyclotetradecane-5,14-dione.
| Compound Name | (2R)-2-methyl-1,4-dioxacyclotetradecane-5,14-dione |
|---|---|
| PubChem CID | 7075077 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2R)-2-methyl-1,4-dioxacyclotetradecane-5,14-dione |
| SMILES | C[C@@H]1COC(=O)CCCCCCCCC(=O)O1 |
| InChI | InChI=1S/C13H22O4/c1-11-10-16-12(14)8-6-4-2-3-5-7-9-13(15)17-11/h11H,2-10H2,1H3/t11-/m1/s1 |
| InChIKey | JOZILNCSRASEMU-LLVKDONJSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |