About 6-methyloxan-2-one;5-methyloxolan-2-one
6-methyloxan-2-one;5-methyloxolan-2-one (PubChem CID 142135496) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is 6-methyloxan-2-one;5-methyloxolan-2-one.
Molecular Properties
| Compound Name | 6-methyloxan-2-one;5-methyloxolan-2-one |
| PubChem CID | 142135496 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 6-methyloxan-2-one;5-methyloxolan-2-one |
| SMILES | CC1CCC(=O)O1.CC1CCCC(=O)O1 |
| InChI | InChI=1S/C6H10O2.C5H8O2/c1-5-3-2-4-6(7)8-5;1-4-2-3-5(6)7-4/h5H,2-4H2,1H3;4H,2-3H2,1H3 |
| InChIKey | ZGXUGJPWPMYVMC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyloxan-2-one;5-methyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyloxan-2-one;5-methyloxolan-2-one?
The IUPAC name of 6-methyloxan-2-one;5-methyloxolan-2-one (CID 142135496) is 6-methyloxan-2-one;5-methyloxolan-2-one.
What is the SMILES notation for 6-methyloxan-2-one;5-methyloxolan-2-one?
The canonical SMILES for 6-methyloxan-2-one;5-methyloxolan-2-one is CC1CCC(=O)O1.CC1CCCC(=O)O1.
What is the InChIKey of 6-methyloxan-2-one;5-methyloxolan-2-one?
The InChIKey is ZGXUGJPWPMYVMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C5H8O2/c1-5-3-2-4-6(7)8-5;1-4-2-3-5(6)7-4/h5H,2-4H2,1H3;4H,2-3H2,1H3.
What are the key properties of 6-methyloxan-2-one;5-methyloxolan-2-one?
6-methyloxan-2-one;5-methyloxolan-2-one has a molecular weight of 214.26 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyloxan-2-one;5-methyloxolan-2-one is sourced from PubChem (CID 142135496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).