C15H26O4 — CID 67348621
9-methyl-1,8-dioxacyclohexadecane-2,7-dione (PubChem CID 67348621) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 9-methyl-1,8-dioxacyclohexadecane-2,7-dione.
| Compound Name | 9-methyl-1,8-dioxacyclohexadecane-2,7-dione |
|---|---|
| PubChem CID | 67348621 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 9-methyl-1,8-dioxacyclohexadecane-2,7-dione |
| SMILES | CC1CCCCCCCOC(=O)CCCCC(=O)O1 |
| InChI | InChI=1S/C15H26O4/c1-13-9-5-3-2-4-8-12-18-14(16)10-6-7-11-15(17)19-13/h13H,2-12H2,1H3 |
| InChIKey | KQBRHXWVQLOFFQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |