C42H78O6 — CID 18738133
11,25,39-trimethyl-1,15,29-trioxacyclodotetracontane-2,16,30-trione (PubChem CID 18738133) has the molecular formula C42H78O6 and a molecular weight of 679.08 g/mol. Its IUPAC name is 11,25,39-trimethyl-1,15,29-trioxacyclodotetracontane-2,16,30-trione.
| Compound Name | 11,25,39-trimethyl-1,15,29-trioxacyclodotetracontane-2,16,30-trione |
|---|---|
| PubChem CID | 18738133 |
| Molecular Formula | C42H78O6 |
| Molecular Weight | 679.08 g/mol |
| Exact Mass | 678.58 |
| IUPAC Name | 11,25,39-trimethyl-1,15,29-trioxacyclodotetracontane-2,16,30-trione |
| SMILES | CC1CCCCCCCCC(=O)OCCCC(C)CCCCCCCCC(=O)OCCCC(C)CCCCCCCCC(=O)OCCC1 |
| InChI | InChI=1S/C42H78O6/c1-37-25-16-10-4-7-13-19-32-41(44)47-35-23-29-39(3)27-18-12-6-9-15-21-33-42(45)48-36-24-30-38(2)26-17-11-5-8-14-20-31-40(43)46-34-22-28-37/h37-39H,4-36H2,1-3H3 |
| InChIKey | XAQMTFQPZOZVRW-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.08 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|