C10H12Cl2O4 — CID 102182327
(4S,6S)-6-tert-butyl-3,3-dichloro-5,7-dioxaspiro[3.4]octane-2,8-dione (PubChem CID 102182327) has the molecular formula C10H12Cl2O4 and a molecular weight of 267.11 g/mol. Its IUPAC name is (4S,6S)-6-tert-butyl-3,3-dichloro-5,7-dioxaspiro[3.4]octane-2,8-dione.
| Compound Name | (4S,6S)-6-tert-butyl-3,3-dichloro-5,7-dioxaspiro[3.4]octane-2,8-dione |
|---|---|
| PubChem CID | 102182327 |
| Molecular Formula | C10H12Cl2O4 |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | (4S,6S)-6-tert-butyl-3,3-dichloro-5,7-dioxaspiro[3.4]octane-2,8-dione |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@]2(CC(=O)C2(Cl)Cl)O1 |
| InChI | InChI=1S/C10H12Cl2O4/c1-8(2,3)7-15-6(14)9(16-7)4-5(13)10(9,11)12/h7H,4H2,1-3H3/t7-,9+/m1/s1 |
| InChIKey | IKQPOJLXSVTSFR-APPZFPTMSA-N |
| XLogP | 1.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|