About 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione
2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione (PubChem CID 141236108) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione |
| PubChem CID | 141236108 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(CO)C(=O)OC(C(C)(C)C)OC1=O |
| InChI | InChI=1S/C10H16O5/c1-9(2,3)8-14-6(12)10(4,5-11)7(13)15-8/h8,11H,5H2,1-4H3 |
| InChIKey | ANJKESHVXDDIQC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione?
The IUPAC name of 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione (CID 141236108) is 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione.
What is the SMILES notation for 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione?
The canonical SMILES for 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione is CC1(CO)C(=O)OC(C(C)(C)C)OC1=O.
What is the InChIKey of 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione?
The InChIKey is ANJKESHVXDDIQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5/c1-9(2,3)8-14-6(12)10(4,5-11)7(13)15-8/h8,11H,5H2,1-4H3.
What are the key properties of 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione?
2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione has a molecular weight of 216.23 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione is sourced from PubChem (CID 141236108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).