C10H16O5 — CID 141236108
2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione (PubChem CID 141236108) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione.
| Compound Name | 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 141236108 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-tert-butyl-5-(hydroxymethyl)-5-methyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(CO)C(=O)OC(C(C)(C)C)OC1=O |
| InChI | InChI=1S/C10H16O5/c1-9(2,3)8-14-6(12)10(4,5-11)7(13)15-8/h8,11H,5H2,1-4H3 |
| InChIKey | ANJKESHVXDDIQC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|