C7H12O4 — CID 101211008
(4R,5S,6S)-4,5-dihydroxy-4,6-dimethyloxan-2-one (PubChem CID 101211008) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (4R,5S,6S)-4,5-dihydroxy-4,6-dimethyloxan-2-one.
| Compound Name | (4R,5S,6S)-4,5-dihydroxy-4,6-dimethyloxan-2-one |
|---|---|
| PubChem CID | 101211008 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (4R,5S,6S)-4,5-dihydroxy-4,6-dimethyloxan-2-one |
| SMILES | C[C@@H]1OC(=O)C[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C7H12O4/c1-4-6(9)7(2,10)3-5(8)11-4/h4,6,9-10H,3H2,1-2H3/t4-,6-,7+/m0/s1 |
| InChIKey | AZYUXMUKVNHLNC-JSKYLQRQSA-N |
| XLogP | -0.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |