C8H12O3 — CID 139586018
(4S,5S)-4,5-dihydroxy-2,5-dimethylcyclohex-2-en-1-one (PubChem CID 139586018) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (4S,5S)-4,5-dihydroxy-2,5-dimethylcyclohex-2-en-1-one.
| Compound Name | (4S,5S)-4,5-dihydroxy-2,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 139586018 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (4S,5S)-4,5-dihydroxy-2,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1=C[C@H](O)[C@@](C)(O)CC1=O |
| InChI | InChI=1S/C8H12O3/c1-5-3-7(10)8(2,11)4-6(5)9/h3,7,10-11H,4H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | XNSWLALPMYBULY-YUMQZZPRSA-N |
| XLogP | 0.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |