C19H22O3 — CID 139654686
4-hydroxy-2,6,6-trimethyl-5-(3-phenylprop-2-enoyl)cyclohept-2-en-1-one (PubChem CID 139654686) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 4-hydroxy-2,6,6-trimethyl-5-(3-phenylprop-2-enoyl)cyclohept-2-en-1-one.
| Compound Name | 4-hydroxy-2,6,6-trimethyl-5-(3-phenylprop-2-enoyl)cyclohept-2-en-1-one |
|---|---|
| PubChem CID | 139654686 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 4-hydroxy-2,6,6-trimethyl-5-(3-phenylprop-2-enoyl)cyclohept-2-en-1-one |
| SMILES | CC1=CC(O)C(C(=O)C=Cc2ccccc2)C(C)(C)CC1=O |
| InChI | InChI=1S/C19H22O3/c1-13-11-16(21)18(19(2,3)12-17(13)22)15(20)10-9-14-7-5-4-6-8-14/h4-11,16,18,21H,12H2,1-3H3 |
| InChIKey | MTFUNTAUDWBKOD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|